C24H29N3O3S — CID 17150093
3-butan-2-yloxy-N-[[2-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide (PubChem CID 17150093) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 3-butan-2-yloxy-N-[[2-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-butan-2-yloxy-N-[[2-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17150093 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 3-butan-2-yloxy-N-[[2-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCC(C)Oc1cccc(C(=O)NC(=S)Nc2ccccc2C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C24H29N3O3S/c1-3-17(2)30-19-11-9-10-18(16-19)22(28)26-24(31)25-21-13-6-5-12-20(21)23(29)27-14-7-4-8-15-27/h5-6,9-13,16-17H,3-4,7-8,14-15H2,1-2H3,(H2,25,26,28,31) |
| InChIKey | GBQVQAZMDHTSJK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|