C27H29N3O3S — CID 17150096
N-benzyl-2-[(3-butan-2-yloxybenzoyl)carbamothioylamino]-N-methylbenzamide (PubChem CID 17150096) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is N-benzyl-2-[(3-butan-2-yloxybenzoyl)carbamothioylamino]-N-methylbenzamide.
| Compound Name | N-benzyl-2-[(3-butan-2-yloxybenzoyl)carbamothioylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 17150096 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-benzyl-2-[(3-butan-2-yloxybenzoyl)carbamothioylamino]-N-methylbenzamide |
| SMILES | CCC(C)Oc1cccc(C(=O)NC(=S)Nc2ccccc2C(=O)N(C)Cc2ccccc2)c1 |
| InChI | InChI=1S/C27H29N3O3S/c1-4-19(2)33-22-14-10-13-21(17-22)25(31)29-27(34)28-24-16-9-8-15-23(24)26(32)30(3)18-20-11-6-5-7-12-20/h5-17,19H,4,18H2,1-3H3,(H2,28,29,31,34) |
| InChIKey | PUUJRRHSDCSEDN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|