C23H20ClN3O2S — CID 4937543
N-benzyl-2-[(4-chlorobenzoyl)carbamothioylamino]-N-methylbenzamide (PubChem CID 4937543) has the molecular formula C23H20ClN3O2S and a molecular weight of 437.95 g/mol. Its IUPAC name is N-benzyl-2-[(4-chlorobenzoyl)carbamothioylamino]-N-methylbenzamide.
| Compound Name | N-benzyl-2-[(4-chlorobenzoyl)carbamothioylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 4937543 |
| Molecular Formula | C23H20ClN3O2S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-benzyl-2-[(4-chlorobenzoyl)carbamothioylamino]-N-methylbenzamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccccc1NC(=S)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClN3O2S/c1-27(15-16-7-3-2-4-8-16)22(29)19-9-5-6-10-20(19)25-23(30)26-21(28)17-11-13-18(24)14-12-17/h2-14H,15H2,1H3,(H2,25,26,28,30) |
| InChIKey | PUKYSVZJWJCWGT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|