C37H39BrN4O3S — CID 17339758
N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-bromo-4-(3-methylbutoxy)benzamide (PubChem CID 17339758) has the molecular formula C37H39BrN4O3S and a molecular weight of 699.71 g/mol. Its IUPAC name is N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-bromo-4-(3-methylbutoxy)benzamide.
| Compound Name | N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-bromo-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17339758 |
| Molecular Formula | C37H39BrN4O3S |
| Molecular Weight | 699.71 g/mol |
| Exact Mass | 698.19 |
| IUPAC Name | N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-bromo-4-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1Br |
| InChI | InChI=1S/C37H39BrN4O3S/c1-26(2)19-24-45-33-18-17-29(25-31(33)38)35(43)40-37(46)39-32-16-10-9-15-30(32)36(44)42-22-20-41(21-23-42)34(27-11-5-3-6-12-27)28-13-7-4-8-14-28/h3-18,25-26,34H,19-24H2,1-2H3,(H2,39,40,43,46) |
| InChIKey | CZWQPPZKMMEBNG-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.71 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|