C27H29BrN2O4S — CID 17131089
3-bromo-4-(3-methylbutoxy)-N-[[2-(2-phenoxyethoxy)phenyl]carbamothioyl]benzamide (PubChem CID 17131089) has the molecular formula C27H29BrN2O4S and a molecular weight of 557.51 g/mol. Its IUPAC name is 3-bromo-4-(3-methylbutoxy)-N-[[2-(2-phenoxyethoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-(3-methylbutoxy)-N-[[2-(2-phenoxyethoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17131089 |
| Molecular Formula | C27H29BrN2O4S |
| Molecular Weight | 557.51 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | 3-bromo-4-(3-methylbutoxy)-N-[[2-(2-phenoxyethoxy)phenyl]carbamothioyl]benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)NC(=S)Nc2ccccc2OCCOc2ccccc2)cc1Br |
| InChI | InChI=1S/C27H29BrN2O4S/c1-19(2)14-15-33-24-13-12-20(18-22(24)28)26(31)30-27(35)29-23-10-6-7-11-25(23)34-17-16-32-21-8-4-3-5-9-21/h3-13,18-19H,14-17H2,1-2H3,(H2,29,30,31,35) |
| InChIKey | WSMFUEGCPFWSNJ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.51 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|