C26H28BrNO4 — CID 17130966
3-bromo-4-(3-methylbutoxy)-N-[2-(2-phenoxyethoxy)phenyl]benzamide (PubChem CID 17130966) has the molecular formula C26H28BrNO4 and a molecular weight of 498.42 g/mol. Its IUPAC name is 3-bromo-4-(3-methylbutoxy)-N-[2-(2-phenoxyethoxy)phenyl]benzamide.
| Compound Name | 3-bromo-4-(3-methylbutoxy)-N-[2-(2-phenoxyethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 17130966 |
| Molecular Formula | C26H28BrNO4 |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 3-bromo-4-(3-methylbutoxy)-N-[2-(2-phenoxyethoxy)phenyl]benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)Nc2ccccc2OCCOc2ccccc2)cc1Br |
| InChI | InChI=1S/C26H28BrNO4/c1-19(2)14-15-31-24-13-12-20(18-22(24)27)26(29)28-23-10-6-7-11-25(23)32-17-16-30-21-8-4-3-5-9-21/h3-13,18-19H,14-17H2,1-2H3,(H,28,29) |
| InChIKey | LCAIQCRQHJQYIE-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|