C24H24BrNO3 — CID 17339336
3-bromo-4-(3-methylbutoxy)-N-(4-phenoxyphenyl)benzamide (PubChem CID 17339336) has the molecular formula C24H24BrNO3 and a molecular weight of 454.36 g/mol. Its IUPAC name is 3-bromo-4-(3-methylbutoxy)-N-(4-phenoxyphenyl)benzamide.
| Compound Name | 3-bromo-4-(3-methylbutoxy)-N-(4-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 17339336 |
| Molecular Formula | C24H24BrNO3 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 3-bromo-4-(3-methylbutoxy)-N-(4-phenoxyphenyl)benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)Nc2ccc(Oc3ccccc3)cc2)cc1Br |
| InChI | InChI=1S/C24H24BrNO3/c1-17(2)14-15-28-23-13-8-18(16-22(23)25)24(27)26-19-9-11-21(12-10-19)29-20-6-4-3-5-7-20/h3-13,16-17H,14-15H2,1-2H3,(H,26,27) |
| InChIKey | JMYAIPKYDLSTFC-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |