C18H18BrCl2NO2 — CID 17339348
3-bromo-N-(3,4-dichlorophenyl)-4-(3-methylbutoxy)benzamide (PubChem CID 17339348) has the molecular formula C18H18BrCl2NO2 and a molecular weight of 431.16 g/mol. Its IUPAC name is 3-bromo-N-(3,4-dichlorophenyl)-4-(3-methylbutoxy)benzamide.
| Compound Name | 3-bromo-N-(3,4-dichlorophenyl)-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17339348 |
| Molecular Formula | C18H18BrCl2NO2 |
| Molecular Weight | 431.16 g/mol |
| Exact Mass | 428.99 |
| IUPAC Name | 3-bromo-N-(3,4-dichlorophenyl)-4-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)Nc2ccc(Cl)c(Cl)c2)cc1Br |
| InChI | InChI=1S/C18H18BrCl2NO2/c1-11(2)7-8-24-17-6-3-12(9-14(17)19)18(23)22-13-4-5-15(20)16(21)10-13/h3-6,9-11H,7-8H2,1-2H3,(H,22,23) |
| InChIKey | HTIGVNBBYKVBDK-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.16 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |