C17H16BrClFNO2 — CID 4955807
3-bromo-4-butoxy-N-(3-chloro-4-fluorophenyl)benzamide (PubChem CID 4955807) has the molecular formula C17H16BrClFNO2 and a molecular weight of 400.68 g/mol. Its IUPAC name is 3-bromo-4-butoxy-N-(3-chloro-4-fluorophenyl)benzamide.
| Compound Name | 3-bromo-4-butoxy-N-(3-chloro-4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 4955807 |
| Molecular Formula | C17H16BrClFNO2 |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 3-bromo-4-butoxy-N-(3-chloro-4-fluorophenyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(F)c(Cl)c2)cc1Br |
| InChI | InChI=1S/C17H16BrClFNO2/c1-2-3-8-23-16-7-4-11(9-13(16)18)17(22)21-12-5-6-15(20)14(19)10-12/h4-7,9-10H,2-3,8H2,1H3,(H,21,22) |
| InChIKey | UXLBTZMEPKIWGS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|