C22H27BrN2O3 — CID 17199544
3-bromo-4-butoxy-N-[4-(tert-butylcarbamoyl)phenyl]benzamide (PubChem CID 17199544) has the molecular formula C22H27BrN2O3 and a molecular weight of 447.37 g/mol. Its IUPAC name is 3-bromo-4-butoxy-N-[4-(tert-butylcarbamoyl)phenyl]benzamide.
| Compound Name | 3-bromo-4-butoxy-N-[4-(tert-butylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17199544 |
| Molecular Formula | C22H27BrN2O3 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 3-bromo-4-butoxy-N-[4-(tert-butylcarbamoyl)phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(C(=O)NC(C)(C)C)cc2)cc1Br |
| InChI | InChI=1S/C22H27BrN2O3/c1-5-6-13-28-19-12-9-16(14-18(19)23)20(26)24-17-10-7-15(8-11-17)21(27)25-22(2,3)4/h7-12,14H,5-6,13H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | HWRBASFJETYHFG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|