C27H30BrNO3 — CID 17131491
3-bromo-4-(3-methylbutoxy)-N-[2-(3-phenylpropoxy)phenyl]benzamide (PubChem CID 17131491) has the molecular formula C27H30BrNO3 and a molecular weight of 496.45 g/mol. Its IUPAC name is 3-bromo-4-(3-methylbutoxy)-N-[2-(3-phenylpropoxy)phenyl]benzamide.
| Compound Name | 3-bromo-4-(3-methylbutoxy)-N-[2-(3-phenylpropoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 17131491 |
| Molecular Formula | C27H30BrNO3 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 3-bromo-4-(3-methylbutoxy)-N-[2-(3-phenylpropoxy)phenyl]benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)Nc2ccccc2OCCCc2ccccc2)cc1Br |
| InChI | InChI=1S/C27H30BrNO3/c1-20(2)16-18-32-25-15-14-22(19-23(25)28)27(30)29-24-12-6-7-13-26(24)31-17-8-11-21-9-4-3-5-10-21/h3-7,9-10,12-15,19-20H,8,11,16-18H2,1-2H3,(H,29,30) |
| InChIKey | RJXVKOUORIUZAZ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|