C30H34N4O2S — CID 4948276
N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-methylbutanamide (PubChem CID 4948276) has the molecular formula C30H34N4O2S and a molecular weight of 514.70 g/mol. Its IUPAC name is N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-methylbutanamide.
| Compound Name | N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 4948276 |
| Molecular Formula | C30H34N4O2S |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | N-[[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]carbamothioyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(=S)Nc1ccccc1C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H34N4O2S/c1-22(2)21-27(35)32-30(37)31-26-16-10-9-15-25(26)29(36)34-19-17-33(18-20-34)28(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h3-16,22,28H,17-21H2,1-2H3,(H2,31,32,35,37) |
| InChIKey | AXJYJJBJOMLXHH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|