C29H27N3O2S — CID 4948035
N-[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]thiophene-2-carboxamide (PubChem CID 4948035) has the molecular formula C29H27N3O2S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4948035 |
| Molecular Formula | C29H27N3O2S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | N-[2-(4-benzhydrylpiperazine-1-carbonyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)c1cccs1 |
| InChI | InChI=1S/C29H27N3O2S/c33-28(26-16-9-21-35-26)30-25-15-8-7-14-24(25)29(34)32-19-17-31(18-20-32)27(22-10-3-1-4-11-22)23-12-5-2-6-13-23/h1-16,21,27H,17-20H2,(H,30,33) |
| InChIKey | DTGJCQIVJYPVFW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |