C17H19N3O2S — CID 119415438
N-[2-(1,4-diazepane-1-carbonyl)phenyl]thiophene-2-carboxamide (PubChem CID 119415438) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is N-[2-(1,4-diazepane-1-carbonyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(1,4-diazepane-1-carbonyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 119415438 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[2-(1,4-diazepane-1-carbonyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)N1CCCNCC1)c1cccs1 |
| InChI | InChI=1S/C17H19N3O2S/c21-16(15-7-3-12-23-15)19-14-6-2-1-5-13(14)17(22)20-10-4-8-18-9-11-20/h1-3,5-7,12,18H,4,8-11H2,(H,19,21) |
| InChIKey | DXPTUNNPAHJJNL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |