C12H15ClN2O — CID 16777333
(2-chlorophenyl)-(1,4-diazepan-1-yl)methanone (PubChem CID 16777333) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is (2-chlorophenyl)-(1,4-diazepan-1-yl)methanone.
| Compound Name | (2-chlorophenyl)-(1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 16777333 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (2-chlorophenyl)-(1,4-diazepan-1-yl)methanone |
| SMILES | O=C(c1ccccc1Cl)N1CCCNCC1 |
| InChI | InChI=1S/C12H15ClN2O/c13-11-5-2-1-4-10(11)12(16)15-8-3-6-14-7-9-15/h1-2,4-5,14H,3,6-9H2 |
| InChIKey | DFHPBCHUERHVNX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |