About piperazine;pyrrolidin-1-yl-(2-sulfanylphenyl)methanone
piperazine;pyrrolidin-1-yl-(2-sulfanylphenyl)methanone (PubChem CID 158455886) has the molecular formula C15H23N3OS
and a molecular weight of 293.44 g/mol. Its IUPAC name is piperazine;pyrrolidin-1-yl-(2-sulfanylphenyl)methanone.
Molecular Properties
| Compound Name | piperazine;pyrrolidin-1-yl-(2-sulfanylphenyl)methanone |
| PubChem CID | 158455886 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | piperazine;pyrrolidin-1-yl-(2-sulfanylphenyl)methanone |
| SMILES | C1CNCCN1.O=C(c1ccccc1S)N1CCCC1 |
| InChI | InChI=1S/C11H13NOS.C4H10N2/c13-11(12-7-3-4-8-12)9-5-1-2-6-10(9)14;1-2-6-4-3-5-1/h1-2,5-6,14H,3-4,7-8H2;5-6H,1-4H2 |
| InChIKey | HEOGPMUGAOOKQA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze piperazine;pyrrolidin-1-yl-(2-sulfanylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine;pyrrolidin-1-yl-(2-sulfanylphenyl)methanone?
The IUPAC name of piperazine;pyrrolidin-1-yl-(2-sulfanylphenyl)methanone (CID 158455886) is piperazine;pyrrolidin-1-yl-(2-sulfanylphenyl)methanone.
What is the SMILES notation for piperazine;pyrrolidin-1-yl-(2-sulfanylphenyl)methanone?
The canonical SMILES for piperazine;pyrrolidin-1-yl-(2-sulfanylphenyl)methanone is C1CNCCN1.O=C(c1ccccc1S)N1CCCC1.
What is the InChIKey of piperazine;pyrrolidin-1-yl-(2-sulfanylphenyl)methanone?
The InChIKey is HEOGPMUGAOOKQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NOS.C4H10N2/c13-11(12-7-3-4-8-12)9-5-1-2-6-10(9)14;1-2-6-4-3-5-1/h1-2,5-6,14H,3-4,7-8H2;5-6H,1-4H2.
What are the key properties of piperazine;pyrrolidin-1-yl-(2-sulfanylphenyl)methanone?
piperazine;pyrrolidin-1-yl-(2-sulfanylphenyl)methanone has a molecular weight of 293.44 g/mol, XLogP of 1.39, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;pyrrolidin-1-yl-(2-sulfanylphenyl)methanone is sourced from PubChem (CID 158455886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).