C26H26N2O2S — CID 108544395
2,2-diphenyl-1-[4-(2-sulfanylbenzoyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 108544395) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is 2,2-diphenyl-1-[4-(2-sulfanylbenzoyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2,2-diphenyl-1-[4-(2-sulfanylbenzoyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 108544395 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2,2-diphenyl-1-[4-(2-sulfanylbenzoyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | O=C(c1ccccc1S)N1CCCN(C(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H26N2O2S/c29-25(22-14-7-8-15-23(22)31)27-16-9-17-28(19-18-27)26(30)24(20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-8,10-15,24,31H,9,16-19H2 |
| InChIKey | DFIMWWZHQXWDID-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|