C12H13NOS — CID 107036222
3,6-dihydro-2H-pyridin-1-yl-(2-sulfanylphenyl)methanone (PubChem CID 107036222) has the molecular formula C12H13NOS and a molecular weight of 219.31 g/mol. Its IUPAC name is 3,6-dihydro-2H-pyridin-1-yl-(2-sulfanylphenyl)methanone.
| Compound Name | 3,6-dihydro-2H-pyridin-1-yl-(2-sulfanylphenyl)methanone |
|---|---|
| PubChem CID | 107036222 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 3,6-dihydro-2H-pyridin-1-yl-(2-sulfanylphenyl)methanone |
| SMILES | O=C(c1ccccc1S)N1CC=CCC1 |
| InChI | InChI=1S/C12H13NOS/c14-12(13-8-4-1-5-9-13)10-6-2-3-7-11(10)15/h1-4,6-7,15H,5,8-9H2 |
| InChIKey | UTQCWKAIPRAPHQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|