C13H11F4NO — CID 115970002
3,6-dihydro-2H-pyridin-1-yl-[2-fluoro-5-(trifluoromethyl)phenyl]methanone (PubChem CID 115970002) has the molecular formula C13H11F4NO and a molecular weight of 273.23 g/mol. Its IUPAC name is 3,6-dihydro-2H-pyridin-1-yl-[2-fluoro-5-(trifluoromethyl)phenyl]methanone.
| Compound Name | 3,6-dihydro-2H-pyridin-1-yl-[2-fluoro-5-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 115970002 |
| Molecular Formula | C13H11F4NO |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3,6-dihydro-2H-pyridin-1-yl-[2-fluoro-5-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)ccc1F)N1CC=CCC1 |
| InChI | InChI=1S/C13H11F4NO/c14-11-5-4-9(13(15,16)17)8-10(11)12(19)18-6-2-1-3-7-18/h1-2,4-5,8H,3,6-7H2 |
| InChIKey | XKQVDLQJESGFBH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|