C16H14F3N3O — CID 166348949
3,6-dihydro-2H-pyridin-1-yl-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methanone (PubChem CID 166348949) has the molecular formula C16H14F3N3O and a molecular weight of 321.30 g/mol. Its IUPAC name is 3,6-dihydro-2H-pyridin-1-yl-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methanone.
| Compound Name | 3,6-dihydro-2H-pyridin-1-yl-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 166348949 |
| Molecular Formula | C16H14F3N3O |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3,6-dihydro-2H-pyridin-1-yl-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methanone |
| SMILES | O=C(c1cn[nH]c1-c1cccc(C(F)(F)F)c1)N1CC=CCC1 |
| InChI | InChI=1S/C16H14F3N3O/c17-16(18,19)12-6-4-5-11(9-12)14-13(10-20-21-14)15(23)22-7-2-1-3-8-22/h1-2,4-6,9-10H,3,7-8H2,(H,20,21) |
| InChIKey | UUVLQDKYOUFHBM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|