C14H16F4N2O — CID 115969458
[3-(1-aminoethyl)pyrrolidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone (PubChem CID 115969458) has the molecular formula C14H16F4N2O and a molecular weight of 304.29 g/mol. Its IUPAC name is [3-(1-aminoethyl)pyrrolidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone.
| Compound Name | [3-(1-aminoethyl)pyrrolidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 115969458 |
| Molecular Formula | C14H16F4N2O |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | [3-(1-aminoethyl)pyrrolidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone |
| SMILES | CC(N)C1CCN(C(=O)c2cc(C(F)(F)F)ccc2F)C1 |
| InChI | InChI=1S/C14H16F4N2O/c1-8(19)9-4-5-20(7-9)13(21)11-6-10(14(16,17)18)2-3-12(11)15/h2-3,6,8-9H,4-5,7,19H2,1H3 |
| InChIKey | BMTOSNOKGOLQOO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |