C15H18F4N2O — CID 100639344
[(3S)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone (PubChem CID 100639344) has the molecular formula C15H18F4N2O and a molecular weight of 318.31 g/mol. Its IUPAC name is [(3S)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(3S)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 100639344 |
| Molecular Formula | C15H18F4N2O |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | [(3S)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone |
| SMILES | C[C@@H](N)[C@H]1CCCN(C(=O)c2cc(C(F)(F)F)ccc2F)C1 |
| InChI | InChI=1S/C15H18F4N2O/c1-9(20)10-3-2-6-21(8-10)14(22)12-7-11(15(17,18)19)4-5-13(12)16/h4-5,7,9-10H,2-3,6,8,20H2,1H3/t9-,10+/m1/s1 |
| InChIKey | TUDOQVCESJFDJO-ZJUUUORDSA-N |
| XLogP | 3.04 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |