C15H18F4N2O — CID 119437495
[2-(1-aminoethyl)piperidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone (PubChem CID 119437495) has the molecular formula C15H18F4N2O and a molecular weight of 318.31 g/mol. Its IUPAC name is [2-(1-aminoethyl)piperidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone.
| Compound Name | [2-(1-aminoethyl)piperidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 119437495 |
| Molecular Formula | C15H18F4N2O |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | [2-(1-aminoethyl)piperidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone |
| SMILES | CC(N)C1CCCCN1C(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C15H18F4N2O/c1-9(20)13-4-2-3-7-21(13)14(22)11-8-10(15(17,18)19)5-6-12(11)16/h5-6,8-9,13H,2-4,7,20H2,1H3 |
| InChIKey | RLAFLGLMWMIQGO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |