C15H20ClF3N2O — CID 119437119
[2-(1-aminoethyl)piperidin-1-yl]-[3-(trifluoromethyl)phenyl]methanone;hydrochloride (PubChem CID 119437119) has the molecular formula C15H20ClF3N2O and a molecular weight of 336.79 g/mol. Its IUPAC name is [2-(1-aminoethyl)piperidin-1-yl]-[3-(trifluoromethyl)phenyl]methanone;hydrochloride.
| Compound Name | [2-(1-aminoethyl)piperidin-1-yl]-[3-(trifluoromethyl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119437119 |
| Molecular Formula | C15H20ClF3N2O |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | [2-(1-aminoethyl)piperidin-1-yl]-[3-(trifluoromethyl)phenyl]methanone;hydrochloride |
| SMILES | CC(N)C1CCCCN1C(=O)c1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C15H19F3N2O.ClH/c1-10(19)13-7-2-3-8-20(13)14(21)11-5-4-6-12(9-11)15(16,17)18;/h4-6,9-10,13H,2-3,7-8,19H2,1H3;1H |
| InChIKey | ARCANVQNQQMWET-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |