C15H21ClN6O — CID 119435840
[2-(1-aminoethyl)piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone;hydrochloride (PubChem CID 119435840) has the molecular formula C15H21ClN6O and a molecular weight of 336.83 g/mol. Its IUPAC name is [2-(1-aminoethyl)piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone;hydrochloride.
| Compound Name | [2-(1-aminoethyl)piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119435840 |
| Molecular Formula | C15H21ClN6O |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [2-(1-aminoethyl)piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone;hydrochloride |
| SMILES | CC(N)C1CCCCN1C(=O)c1cccc(-n2cnnn2)c1.Cl |
| InChI | InChI=1S/C15H20N6O.ClH/c1-11(16)14-7-2-3-8-20(14)15(22)12-5-4-6-13(9-12)21-10-17-18-19-21;/h4-6,9-11,14H,2-3,7-8,16H2,1H3;1H |
| InChIKey | VDIACVDFBFJCPL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |