C17H21FN4O — CID 124569387
[(2R)-2-[(1S)-1-aminoethyl]piperidin-1-yl]-[1-(3-fluorophenyl)pyrazol-3-yl]methanone (PubChem CID 124569387) has the molecular formula C17H21FN4O and a molecular weight of 316.38 g/mol. Its IUPAC name is [(2R)-2-[(1S)-1-aminoethyl]piperidin-1-yl]-[1-(3-fluorophenyl)pyrazol-3-yl]methanone.
| Compound Name | [(2R)-2-[(1S)-1-aminoethyl]piperidin-1-yl]-[1-(3-fluorophenyl)pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 124569387 |
| Molecular Formula | C17H21FN4O |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [(2R)-2-[(1S)-1-aminoethyl]piperidin-1-yl]-[1-(3-fluorophenyl)pyrazol-3-yl]methanone |
| SMILES | C[C@H](N)[C@H]1CCCCN1C(=O)c1ccn(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C17H21FN4O/c1-12(19)16-7-2-3-9-21(16)17(23)15-8-10-22(20-15)14-6-4-5-13(18)11-14/h4-6,8,10-12,16H,2-3,7,9,19H2,1H3/t12-,16+/m0/s1 |
| InChIKey | BDNSASWESJMYBW-BLLLJJGKSA-N |
| XLogP | 2.35 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |