C18H29ClN4O2 — CID 119435979
1-[3-[2-(1-aminoethyl)piperidine-1-carbonyl]phenyl]-3-propan-2-ylurea;hydrochloride (PubChem CID 119435979) has the molecular formula C18H29ClN4O2 and a molecular weight of 368.91 g/mol. Its IUPAC name is 1-[3-[2-(1-aminoethyl)piperidine-1-carbonyl]phenyl]-3-propan-2-ylurea;hydrochloride.
| Compound Name | 1-[3-[2-(1-aminoethyl)piperidine-1-carbonyl]phenyl]-3-propan-2-ylurea;hydrochloride |
|---|---|
| PubChem CID | 119435979 |
| Molecular Formula | C18H29ClN4O2 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-[3-[2-(1-aminoethyl)piperidine-1-carbonyl]phenyl]-3-propan-2-ylurea;hydrochloride |
| SMILES | CC(C)NC(=O)Nc1cccc(C(=O)N2CCCCC2C(C)N)c1.Cl |
| InChI | InChI=1S/C18H28N4O2.ClH/c1-12(2)20-18(24)21-15-8-6-7-14(11-15)17(23)22-10-5-4-9-16(22)13(3)19;/h6-8,11-13,16H,4-5,9-10,19H2,1-3H3,(H2,20,21,24);1H |
| InChIKey | PXCXHGQGPNIEBE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |