C17H23N3O4 — CID 119322240
methyl 1-[3-[[(2S)-2-aminopropanoyl]amino]benzoyl]piperidine-2-carboxylate (PubChem CID 119322240) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is methyl 1-[3-[[(2S)-2-aminopropanoyl]amino]benzoyl]piperidine-2-carboxylate.
| Compound Name | methyl 1-[3-[[(2S)-2-aminopropanoyl]amino]benzoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 119322240 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | methyl 1-[3-[[(2S)-2-aminopropanoyl]amino]benzoyl]piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1C(=O)c1cccc(NC(=O)[C@H](C)N)c1 |
| InChI | InChI=1S/C17H23N3O4/c1-11(18)15(21)19-13-7-5-6-12(10-13)16(22)20-9-4-3-8-14(20)17(23)24-2/h5-7,10-11,14H,3-4,8-9,18H2,1-2H3,(H,19,21)/t11-,14?/m0/s1 |
| InChIKey | HCPLZBMHOWIELB-ZSOXZCCMSA-N |
| XLogP | 1.14 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |