C22H25N3O4 — CID 119781221
methyl 1-[3-[[2-(4-aminophenyl)acetyl]amino]benzoyl]piperidine-2-carboxylate (PubChem CID 119781221) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is methyl 1-[3-[[2-(4-aminophenyl)acetyl]amino]benzoyl]piperidine-2-carboxylate.
| Compound Name | methyl 1-[3-[[2-(4-aminophenyl)acetyl]amino]benzoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 119781221 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | methyl 1-[3-[[2-(4-aminophenyl)acetyl]amino]benzoyl]piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1C(=O)c1cccc(NC(=O)Cc2ccc(N)cc2)c1 |
| InChI | InChI=1S/C22H25N3O4/c1-29-22(28)19-7-2-3-12-25(19)21(27)16-5-4-6-18(14-16)24-20(26)13-15-8-10-17(23)11-9-15/h4-6,8-11,14,19H,2-3,7,12-13,23H2,1H3,(H,24,26) |
| InChIKey | DSDBXQLKTDVKBR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|