C21H29N3O4 — CID 119781229
methyl 1-[3-[(3-aminocyclohexanecarbonyl)amino]benzoyl]piperidine-2-carboxylate (PubChem CID 119781229) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is methyl 1-[3-[(3-aminocyclohexanecarbonyl)amino]benzoyl]piperidine-2-carboxylate.
| Compound Name | methyl 1-[3-[(3-aminocyclohexanecarbonyl)amino]benzoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 119781229 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | methyl 1-[3-[(3-aminocyclohexanecarbonyl)amino]benzoyl]piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1C(=O)c1cccc(NC(=O)C2CCCC(N)C2)c1 |
| InChI | InChI=1S/C21H29N3O4/c1-28-21(27)18-10-2-3-11-24(18)20(26)15-7-5-9-17(13-15)23-19(25)14-6-4-8-16(22)12-14/h5,7,9,13-14,16,18H,2-4,6,8,10-12,22H2,1H3,(H,23,25) |
| InChIKey | FFDWJRTXLWMTFZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |