C14H14ClF4NO — CID 114801193
[3-(2-chloroethyl)pyrrolidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone (PubChem CID 114801193) has the molecular formula C14H14ClF4NO and a molecular weight of 323.72 g/mol. Its IUPAC name is [3-(2-chloroethyl)pyrrolidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone.
| Compound Name | [3-(2-chloroethyl)pyrrolidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 114801193 |
| Molecular Formula | C14H14ClF4NO |
| Molecular Weight | 323.72 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | [3-(2-chloroethyl)pyrrolidin-1-yl]-[2-fluoro-5-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)ccc1F)N1CCC(CCCl)C1 |
| InChI | InChI=1S/C14H14ClF4NO/c15-5-3-9-4-6-20(8-9)13(21)11-7-10(14(17,18)19)1-2-12(11)16/h1-2,7,9H,3-6,8H2 |
| InChIKey | ORMLFAANQMQBLR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.72 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|