C13H14BrClFNO — CID 114801371
(2-bromo-5-fluorophenyl)-[3-(2-chloroethyl)pyrrolidin-1-yl]methanone (PubChem CID 114801371) has the molecular formula C13H14BrClFNO and a molecular weight of 334.62 g/mol. Its IUPAC name is (2-bromo-5-fluorophenyl)-[3-(2-chloroethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (2-bromo-5-fluorophenyl)-[3-(2-chloroethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 114801371 |
| Molecular Formula | C13H14BrClFNO |
| Molecular Weight | 334.62 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | (2-bromo-5-fluorophenyl)-[3-(2-chloroethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc(F)ccc1Br)N1CCC(CCCl)C1 |
| InChI | InChI=1S/C13H14BrClFNO/c14-12-2-1-10(16)7-11(12)13(18)17-6-4-9(8-17)3-5-15/h1-2,7,9H,3-6,8H2 |
| InChIKey | VFTRGFMILZUBTP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.62 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|