C16H19BrFNO — CID 9225712
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-bromo-5-fluorophenyl)methanone (PubChem CID 9225712) has the molecular formula C16H19BrFNO and a molecular weight of 340.24 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-bromo-5-fluorophenyl)methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-bromo-5-fluorophenyl)methanone |
|---|---|
| PubChem CID | 9225712 |
| Molecular Formula | C16H19BrFNO |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(2-bromo-5-fluorophenyl)methanone |
| SMILES | O=C(c1cc(F)ccc1Br)N1CC[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C16H19BrFNO/c17-15-6-5-13(18)9-14(15)16(20)19-8-7-11-3-1-2-4-12(11)10-19/h5-6,9,11-12H,1-4,7-8,10H2/t11-,12-/m0/s1 |
| InChIKey | KJBPWHOGFSITEG-RYUDHWBXSA-N |
| XLogP | 4.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |