C16H20F2N2O — CID 107120588
3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(3-amino-2,5-difluorophenyl)methanone (PubChem CID 107120588) has the molecular formula C16H20F2N2O and a molecular weight of 294.34 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(3-amino-2,5-difluorophenyl)methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(3-amino-2,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 107120588 |
| Molecular Formula | C16H20F2N2O |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(3-amino-2,5-difluorophenyl)methanone |
| SMILES | Nc1cc(F)cc(C(=O)N2CCC3CCCCC3C2)c1F |
| InChI | InChI=1S/C16H20F2N2O/c17-12-7-13(15(18)14(19)8-12)16(21)20-6-5-10-3-1-2-4-11(10)9-20/h7-8,10-11H,1-6,9,19H2 |
| InChIKey | YACYEVBBVHICPI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|