C13H14F2N2O2 — CID 107210357
(3-amino-2,5-difluorophenyl)-(3-cyclopropyl-3-hydroxyazetidin-1-yl)methanone (PubChem CID 107210357) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is (3-amino-2,5-difluorophenyl)-(3-cyclopropyl-3-hydroxyazetidin-1-yl)methanone.
| Compound Name | (3-amino-2,5-difluorophenyl)-(3-cyclopropyl-3-hydroxyazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 107210357 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (3-amino-2,5-difluorophenyl)-(3-cyclopropyl-3-hydroxyazetidin-1-yl)methanone |
| SMILES | Nc1cc(F)cc(C(=O)N2CC(O)(C3CC3)C2)c1F |
| InChI | InChI=1S/C13H14F2N2O2/c14-8-3-9(11(15)10(16)4-8)12(18)17-5-13(19,6-17)7-1-2-7/h3-4,7,19H,1-2,5-6,16H2 |
| InChIKey | IMSDKAYXYDKHLN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|