C14H18N2O3 — CID 107210340
(2-amino-5-methoxyphenyl)-(3-cyclopropyl-3-hydroxyazetidin-1-yl)methanone (PubChem CID 107210340) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is (2-amino-5-methoxyphenyl)-(3-cyclopropyl-3-hydroxyazetidin-1-yl)methanone.
| Compound Name | (2-amino-5-methoxyphenyl)-(3-cyclopropyl-3-hydroxyazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 107210340 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (2-amino-5-methoxyphenyl)-(3-cyclopropyl-3-hydroxyazetidin-1-yl)methanone |
| SMILES | COc1ccc(N)c(C(=O)N2CC(O)(C3CC3)C2)c1 |
| InChI | InChI=1S/C14H18N2O3/c1-19-10-4-5-12(15)11(6-10)13(17)16-7-14(18,8-16)9-2-3-9/h4-6,9,18H,2-3,7-8,15H2,1H3 |
| InChIKey | UHKQMJZWDALUJO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|