C14H18N2O4 — CID 115413469
(2S)-1-(2-amino-5-methoxybenzoyl)piperidine-2-carboxylic acid (PubChem CID 115413469) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (2S)-1-(2-amino-5-methoxybenzoyl)piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-(2-amino-5-methoxybenzoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 115413469 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2S)-1-(2-amino-5-methoxybenzoyl)piperidine-2-carboxylic acid |
| SMILES | COc1ccc(N)c(C(=O)N2CCCC[C@H]2C(=O)O)c1 |
| InChI | InChI=1S/C14H18N2O4/c1-20-9-5-6-11(15)10(8-9)13(17)16-7-3-2-4-12(16)14(18)19/h5-6,8,12H,2-4,7,15H2,1H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | GSNKQUZOUKXYED-LBPRGKRZSA-N |
| XLogP | 1.36 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|