C19H23N3O5 — CID 11176244
5-(2-amino-5-methoxybenzoyl)-2-(cyclohexanecarbonyl)-3,4-dihydropyrazole-3-carboxylic acid (PubChem CID 11176244) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 5-(2-amino-5-methoxybenzoyl)-2-(cyclohexanecarbonyl)-3,4-dihydropyrazole-3-carboxylic acid.
| Compound Name | 5-(2-amino-5-methoxybenzoyl)-2-(cyclohexanecarbonyl)-3,4-dihydropyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 11176244 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 5-(2-amino-5-methoxybenzoyl)-2-(cyclohexanecarbonyl)-3,4-dihydropyrazole-3-carboxylic acid |
| SMILES | COc1ccc(N)c(C(=O)C2=NN(C(=O)C3CCCCC3)C(C(=O)O)C2)c1 |
| InChI | InChI=1S/C19H23N3O5/c1-27-12-7-8-14(20)13(9-12)17(23)15-10-16(19(25)26)22(21-15)18(24)11-5-3-2-4-6-11/h7-9,11,16H,2-6,10,20H2,1H3,(H,25,26) |
| InChIKey | VMXXRMXAWSUPEE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|