C16H21N3O4 — CID 44563775
ethyl 5-(2-amino-5-methoxybenzoyl)-2-ethyl-3,4-dihydropyrazole-3-carboxylate (PubChem CID 44563775) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is ethyl 5-(2-amino-5-methoxybenzoyl)-2-ethyl-3,4-dihydropyrazole-3-carboxylate.
| Compound Name | ethyl 5-(2-amino-5-methoxybenzoyl)-2-ethyl-3,4-dihydropyrazole-3-carboxylate |
|---|---|
| PubChem CID | 44563775 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | ethyl 5-(2-amino-5-methoxybenzoyl)-2-ethyl-3,4-dihydropyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1CC(C(=O)c2cc(OC)ccc2N)=NN1CC |
| InChI | InChI=1S/C16H21N3O4/c1-4-19-14(16(21)23-5-2)9-13(18-19)15(20)11-8-10(22-3)6-7-12(11)17/h6-8,14H,4-5,9,17H2,1-3H3 |
| InChIKey | WJNZPFQADWOQDT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|