C15H20F2N2O — CID 107121163
(3-amino-2,5-difluorophenyl)-(4,4-dimethylazepan-1-yl)methanone (PubChem CID 107121163) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is (3-amino-2,5-difluorophenyl)-(4,4-dimethylazepan-1-yl)methanone.
| Compound Name | (3-amino-2,5-difluorophenyl)-(4,4-dimethylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 107121163 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (3-amino-2,5-difluorophenyl)-(4,4-dimethylazepan-1-yl)methanone |
| SMILES | CC1(C)CCCN(C(=O)c2cc(F)cc(N)c2F)CC1 |
| InChI | InChI=1S/C15H20F2N2O/c1-15(2)4-3-6-19(7-5-15)14(20)11-8-10(16)9-12(18)13(11)17/h8-9H,3-7,18H2,1-2H3 |
| InChIKey | KFZJIBULSCFOLF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|