C16H22F2N2O — CID 107121117
(3-amino-2,5-difluorophenyl)-(4-propylazepan-1-yl)methanone (PubChem CID 107121117) has the molecular formula C16H22F2N2O and a molecular weight of 296.36 g/mol. Its IUPAC name is (3-amino-2,5-difluorophenyl)-(4-propylazepan-1-yl)methanone.
| Compound Name | (3-amino-2,5-difluorophenyl)-(4-propylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 107121117 |
| Molecular Formula | C16H22F2N2O |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | (3-amino-2,5-difluorophenyl)-(4-propylazepan-1-yl)methanone |
| SMILES | CCCC1CCCN(C(=O)c2cc(F)cc(N)c2F)CC1 |
| InChI | InChI=1S/C16H22F2N2O/c1-2-4-11-5-3-7-20(8-6-11)16(21)13-9-12(17)10-14(19)15(13)18/h9-11H,2-8,19H2,1H3 |
| InChIKey | ZWIITGADYAVQOR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|