C17H22FNO — CID 80718141
3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(2-fluoro-3-methylphenyl)methanone (PubChem CID 80718141) has the molecular formula C17H22FNO and a molecular weight of 275.37 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(2-fluoro-3-methylphenyl)methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(2-fluoro-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 80718141 |
| Molecular Formula | C17H22FNO |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(2-fluoro-3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)N2CCC3CCCCC3C2)c1F |
| InChI | InChI=1S/C17H22FNO/c1-12-5-4-8-15(16(12)18)17(20)19-10-9-13-6-2-3-7-14(13)11-19/h4-5,8,13-14H,2-3,6-7,9-11H2,1H3 |
| InChIKey | HQFBZBXRWPJSHT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |