C16H20FNO2 — CID 104916531
3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(2-fluoro-6-hydroxyphenyl)methanone (PubChem CID 104916531) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(2-fluoro-6-hydroxyphenyl)methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(2-fluoro-6-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 104916531 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(2-fluoro-6-hydroxyphenyl)methanone |
| SMILES | O=C(c1c(O)cccc1F)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C16H20FNO2/c17-13-6-3-7-14(19)15(13)16(20)18-9-8-11-4-1-2-5-12(11)10-18/h3,6-7,11-12,19H,1-2,4-5,8-10H2 |
| InChIKey | KTIMROPLGBDLPW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |