C23H32N2O2 — CID 40880014
[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-(2-methylbenzoyl)piperidin-4-yl]methanone (PubChem CID 40880014) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-(2-methylbenzoyl)piperidin-4-yl]methanone.
| Compound Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-(2-methylbenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 40880014 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-(2-methylbenzoyl)piperidin-4-yl]methanone |
| SMILES | Cc1ccccc1C(=O)N1CCC(C(=O)N2CC[C@@H]3CCCC[C@@H]3C2)CC1 |
| InChI | InChI=1S/C23H32N2O2/c1-17-6-2-5-9-21(17)23(27)24-13-11-19(12-14-24)22(26)25-15-10-18-7-3-4-8-20(18)16-25/h2,5-6,9,18-20H,3-4,7-8,10-16H2,1H3/t18-,20+/m0/s1 |
| InChIKey | UCEOHTCNFKWNQQ-AZUAARDMSA-N |
| XLogP | 3.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |