C22H29ClN2O2 — CID 9296520
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-(4-chlorobenzoyl)piperidin-4-yl]methanone (PubChem CID 9296520) has the molecular formula C22H29ClN2O2 and a molecular weight of 388.94 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-(4-chlorobenzoyl)piperidin-4-yl]methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-(4-chlorobenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 9296520 |
| Molecular Formula | C22H29ClN2O2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-(4-chlorobenzoyl)piperidin-4-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCC(C(=O)N2CC[C@@H]3CCCC[C@H]3C2)CC1 |
| InChI | InChI=1S/C22H29ClN2O2/c23-20-7-5-17(6-8-20)21(26)24-12-10-18(11-13-24)22(27)25-14-9-16-3-1-2-4-19(16)15-25/h5-8,16,18-19H,1-4,9-15H2/t16-,19-/m0/s1 |
| InChIKey | OKFOZWFRFMZOJI-LPHOPBHVSA-N |
| XLogP | 4.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |