C21H30N2O2 — CID 134029841
azepan-1-yl-[1-(2,3-dimethylbenzoyl)piperidin-4-yl]methanone (PubChem CID 134029841) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is azepan-1-yl-[1-(2,3-dimethylbenzoyl)piperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-(2,3-dimethylbenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 134029841 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | azepan-1-yl-[1-(2,3-dimethylbenzoyl)piperidin-4-yl]methanone |
| SMILES | Cc1cccc(C(=O)N2CCC(C(=O)N3CCCCCC3)CC2)c1C |
| InChI | InChI=1S/C21H30N2O2/c1-16-8-7-9-19(17(16)2)21(25)23-14-10-18(11-15-23)20(24)22-12-5-3-4-6-13-22/h7-9,18H,3-6,10-15H2,1-2H3 |
| InChIKey | FAZUIRCTOFRLCU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |