C15H21NO — CID 78783803
(2,3-dimethylphenyl)-(3-methylpiperidin-1-yl)methanone (PubChem CID 78783803) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-(3-methylpiperidin-1-yl)methanone.
| Compound Name | (2,3-dimethylphenyl)-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 78783803 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (2,3-dimethylphenyl)-(3-methylpiperidin-1-yl)methanone |
| SMILES | Cc1cccc(C(=O)N2CCCC(C)C2)c1C |
| InChI | InChI=1S/C15H21NO/c1-11-6-5-9-16(10-11)15(17)14-8-4-7-12(2)13(14)3/h4,7-8,11H,5-6,9-10H2,1-3H3 |
| InChIKey | HVHDWDSPMHHXOH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |