C20H24N2O3S — CID 41368481
N-[2-methyl-3-[(3S)-3-methylpiperidine-1-carbonyl]phenyl]benzenesulfonamide (PubChem CID 41368481) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-[2-methyl-3-[(3S)-3-methylpiperidine-1-carbonyl]phenyl]benzenesulfonamide.
| Compound Name | N-[2-methyl-3-[(3S)-3-methylpiperidine-1-carbonyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 41368481 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[2-methyl-3-[(3S)-3-methylpiperidine-1-carbonyl]phenyl]benzenesulfonamide |
| SMILES | Cc1c(NS(=O)(=O)c2ccccc2)cccc1C(=O)N1CCC[C@H](C)C1 |
| InChI | InChI=1S/C20H24N2O3S/c1-15-8-7-13-22(14-15)20(23)18-11-6-12-19(16(18)2)21-26(24,25)17-9-4-3-5-10-17/h3-6,9-12,15,21H,7-8,13-14H2,1-2H3/t15-/m0/s1 |
| InChIKey | CRZQZWJHVKPHCW-HNNXBMFYSA-N |
| XLogP | 3.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |