C17H19NO — CID 4284306
(3-methylpiperidin-1-yl)-naphthalen-1-ylmethanone (PubChem CID 4284306) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is (3-methylpiperidin-1-yl)-naphthalen-1-ylmethanone.
| Compound Name | (3-methylpiperidin-1-yl)-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 4284306 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (3-methylpiperidin-1-yl)-naphthalen-1-ylmethanone |
| SMILES | CC1CCCN(C(=O)c2cccc3ccccc23)C1 |
| InChI | InChI=1S/C17H19NO/c1-13-6-5-11-18(12-13)17(19)16-10-4-8-14-7-2-3-9-15(14)16/h2-4,7-10,13H,5-6,11-12H2,1H3 |
| InChIKey | FXEYREUKSBZEDG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |