C27H35N3O2 — CID 31611501
azepan-1-yl-[1-[2-(2,3-dimethylanilino)benzoyl]piperidin-4-yl]methanone (PubChem CID 31611501) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is azepan-1-yl-[1-[2-(2,3-dimethylanilino)benzoyl]piperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-[2-(2,3-dimethylanilino)benzoyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 31611501 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | azepan-1-yl-[1-[2-(2,3-dimethylanilino)benzoyl]piperidin-4-yl]methanone |
| SMILES | Cc1cccc(Nc2ccccc2C(=O)N2CCC(C(=O)N3CCCCCC3)CC2)c1C |
| InChI | InChI=1S/C27H35N3O2/c1-20-10-9-13-24(21(20)2)28-25-12-6-5-11-23(25)27(32)30-18-14-22(15-19-30)26(31)29-16-7-3-4-8-17-29/h5-6,9-13,22,28H,3-4,7-8,14-19H2,1-2H3 |
| InChIKey | XKWAVBKAWQTPDN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |